C26H29F3N8O2S — CID 178172933
1-N-[2-(dimethylamino)ethyl]-4-N-[4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]pyrimidin-2-yl]-1-N-methyl-5-(2,2,2-trifluoroethoxy)benzene-1,2,4-triamine (PubChem CID 178172933) has the molecular formula C26H29F3N8O2S and a molecular weight of 574.63 g/mol. Its IUPAC name is 1-N-[2-(dimethylamino)ethyl]-4-N-[4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]pyrimidin-2-yl]-1-N-methyl-5-(2,2,2-trifluoroethoxy)benzene-1,2,4-triamine.
| Compound Name | 1-N-[2-(dimethylamino)ethyl]-4-N-[4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]pyrimidin-2-yl]-1-N-methyl-5-(2,2,2-trifluoroethoxy)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 178172933 |
| Molecular Formula | C26H29F3N8O2S |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | 1-N-[2-(dimethylamino)ethyl]-4-N-[4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]pyrimidin-2-yl]-1-N-methyl-5-(2,2,2-trifluoroethoxy)benzene-1,2,4-triamine |
| SMILES | COc1ccc(-c2nnc(-c3ccnc(Nc4cc(N)c(N(C)CCN(C)C)cc4OCC(F)(F)F)n3)s2)cc1 |
| InChI | InChI=1S/C26H29F3N8O2S/c1-36(2)11-12-37(3)21-14-22(39-15-26(27,28)29)20(13-18(21)30)33-25-31-10-9-19(32-25)24-35-34-23(40-24)16-5-7-17(38-4)8-6-16/h5-10,13-14H,11-12,15,30H2,1-4H3,(H,31,32,33) |
| InChIKey | NCGJWSFGUFRGAC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|