C8H20N2O — CID 178173118
N'-ethyl-1-methoxy-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 178173118) has the molecular formula C8H20N2O and a molecular weight of 160.26 g/mol. Its IUPAC name is N'-ethyl-1-methoxy-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-ethyl-1-methoxy-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 178173118 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | N'-ethyl-1-methoxy-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CCN(C)CC(OC)N(C)C |
| InChI | InChI=1S/C8H20N2O/c1-6-10(4)7-8(11-5)9(2)3/h8H,6-7H2,1-5H3 |
| InChIKey | VOJDFDPTJRWMNK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|