C13H29NO — CID 178173229
ethane;2,2,6,6-tetramethyl-4-propan-2-ylmorpholine (PubChem CID 178173229) has the molecular formula C13H29NO and a molecular weight of 215.38 g/mol. Its IUPAC name is ethane;2,2,6,6-tetramethyl-4-propan-2-ylmorpholine.
| Compound Name | ethane;2,2,6,6-tetramethyl-4-propan-2-ylmorpholine |
|---|---|
| PubChem CID | 178173229 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | ethane;2,2,6,6-tetramethyl-4-propan-2-ylmorpholine |
| SMILES | CC.CC(C)N1CC(C)(C)OC(C)(C)C1 |
| InChI | InChI=1S/C11H23NO.C2H6/c1-9(2)12-7-10(3,4)13-11(5,6)8-12;1-2/h9H,7-8H2,1-6H3;1-2H3 |
| InChIKey | BWFFOMDDXRYNJB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |