C11H23F2NO — CID 178173556
6,6-difluoro-1-propan-2-ylazepan-3-ol;ethane (PubChem CID 178173556) has the molecular formula C11H23F2NO and a molecular weight of 223.31 g/mol. Its IUPAC name is 6,6-difluoro-1-propan-2-ylazepan-3-ol;ethane.
| Compound Name | 6,6-difluoro-1-propan-2-ylazepan-3-ol;ethane |
|---|---|
| PubChem CID | 178173556 |
| Molecular Formula | C11H23F2NO |
| Molecular Weight | 223.31 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 6,6-difluoro-1-propan-2-ylazepan-3-ol;ethane |
| SMILES | CC.CC(C)N1CC(O)CCC(F)(F)C1 |
| InChI | InChI=1S/C9H17F2NO.C2H6/c1-7(2)12-5-8(13)3-4-9(10,11)6-12;1-2/h7-8,13H,3-6H2,1-2H3;1-2H3 |
| InChIKey | PAQZKVKSYBOCGL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |