C28H41N5O4Si — CID 178173807
3-(14-oxospiro[1,4,13-triazatetracyclo[7.5.2.04,16.012,15]hexadeca-9(16),10,12(15)-triene-6,4'-piperidine]-13-yl)-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione (PubChem CID 178173807) has the molecular formula C28H41N5O4Si and a molecular weight of 539.75 g/mol. Its IUPAC name is 3-(14-oxospiro[1,4,13-triazatetracyclo[7.5.2.04,16.012,15]hexadeca-9(16),10,12(15)-triene-6,4'-piperidine]-13-yl)-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione.
| Compound Name | 3-(14-oxospiro[1,4,13-triazatetracyclo[7.5.2.04,16.012,15]hexadeca-9(16),10,12(15)-triene-6,4'-piperidine]-13-yl)-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 178173807 |
| Molecular Formula | C28H41N5O4Si |
| Molecular Weight | 539.75 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | 3-(14-oxospiro[1,4,13-triazatetracyclo[7.5.2.04,16.012,15]hexadeca-9(16),10,12(15)-triene-6,4'-piperidine]-13-yl)-1-(2-trimethylsilylethoxymethyl)piperidine-2,6-dione |
| SMILES | C[Si](C)(C)CCOCN1C(=O)CCC(n2c(=O)n3c4c5c(ccc42)CCC2(CCNCC2)CN5CC3)C1=O |
| InChI | InChI=1S/C28H41N5O4Si/c1-38(2,3)17-16-37-19-32-23(34)7-6-22(26(32)35)33-21-5-4-20-8-9-28(10-12-29-13-11-28)18-30-14-15-31(27(33)36)25(21)24(20)30/h4-5,22,29H,6-19H2,1-3H3 |
| InChIKey | XWILINFKPOUADL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 88.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.75 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|