C33H46N2O3 — CID 178174497
5-(azetidin-3-yloxy)-2-methyl-N-[1-[3-[5-(2-methylpropyl)furan-2-yl]phenyl]ethyl]benzamide;hexane (PubChem CID 178174497) has the molecular formula C33H46N2O3 and a molecular weight of 518.74 g/mol. Its IUPAC name is 5-(azetidin-3-yloxy)-2-methyl-N-[1-[3-[5-(2-methylpropyl)furan-2-yl]phenyl]ethyl]benzamide;hexane.
| Compound Name | 5-(azetidin-3-yloxy)-2-methyl-N-[1-[3-[5-(2-methylpropyl)furan-2-yl]phenyl]ethyl]benzamide;hexane |
|---|---|
| PubChem CID | 178174497 |
| Molecular Formula | C33H46N2O3 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.35 |
| IUPAC Name | 5-(azetidin-3-yloxy)-2-methyl-N-[1-[3-[5-(2-methylpropyl)furan-2-yl]phenyl]ethyl]benzamide;hexane |
| SMILES | CCCCCC.Cc1ccc(OC2CNC2)cc1C(=O)NC(C)c1cccc(-c2ccc(CC(C)C)o2)c1 |
| InChI | InChI=1S/C27H32N2O3.C6H14/c1-17(2)12-22-10-11-26(32-22)21-7-5-6-20(13-21)19(4)29-27(30)25-14-23(9-8-18(25)3)31-24-15-28-16-24;1-3-5-6-4-2/h5-11,13-14,17,19,24,28H,12,15-16H2,1-4H3,(H,29,30);3-6H2,1-2H3 |
| InChIKey | GXMOASDLPQYNNQ-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|