About 1-(5-cyclopropyl-1,2-oxazol-3-yl)ethanone;ethane
1-(5-cyclopropyl-1,2-oxazol-3-yl)ethanone;ethane (PubChem CID 178176268) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 1-(5-cyclopropyl-1,2-oxazol-3-yl)ethanone;ethane.
Molecular Properties
| Compound Name | 1-(5-cyclopropyl-1,2-oxazol-3-yl)ethanone;ethane |
| PubChem CID | 178176268 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 1-(5-cyclopropyl-1,2-oxazol-3-yl)ethanone;ethane |
| SMILES | CC.CC(=O)c1cc(C2CC2)on1 |
| InChI | InChI=1S/C8H9NO2.C2H6/c1-5(10)7-4-8(11-9-7)6-2-3-6;1-2/h4,6H,2-3H2,1H3;1-2H3 |
| InChIKey | NAOJGFUCGVXKQH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5-cyclopropyl-1,2-oxazol-3-yl)ethanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-cyclopropyl-1,2-oxazol-3-yl)ethanone;ethane?
The IUPAC name of 1-(5-cyclopropyl-1,2-oxazol-3-yl)ethanone;ethane (CID 178176268) is 1-(5-cyclopropyl-1,2-oxazol-3-yl)ethanone;ethane.
What is the SMILES notation for 1-(5-cyclopropyl-1,2-oxazol-3-yl)ethanone;ethane?
The canonical SMILES for 1-(5-cyclopropyl-1,2-oxazol-3-yl)ethanone;ethane is CC.CC(=O)c1cc(C2CC2)on1.
What is the InChIKey of 1-(5-cyclopropyl-1,2-oxazol-3-yl)ethanone;ethane?
The InChIKey is NAOJGFUCGVXKQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C2H6/c1-5(10)7-4-8(11-9-7)6-2-3-6;1-2/h4,6H,2-3H2,1H3;1-2H3.
What are the key properties of 1-(5-cyclopropyl-1,2-oxazol-3-yl)ethanone;ethane?
1-(5-cyclopropyl-1,2-oxazol-3-yl)ethanone;ethane has a molecular weight of 181.23 g/mol, XLogP of 2.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-cyclopropyl-1,2-oxazol-3-yl)ethanone;ethane is sourced from PubChem (CID 178176268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).