About CID 178177294
CID 178177294 (PubChem CID 178177294) has the molecular formula C15H12BNO
and a molecular weight of 233.08 g/mol.
Molecular Properties
| Compound Name | CID 178177294 |
| PubChem CID | 178177294 |
| Molecular Formula | C15H12BNO |
| Molecular Weight | 233.08 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2ccn(/C(C=C)=C/C=C)c(=O)c2c1 |
| InChI | InChI=1S/C15H12BNO/c1-3-5-13(4-2)17-9-8-11-6-7-12(16)10-14(11)15(17)18/h3-10H,1-2H2/b13-5+ |
| InChIKey | IVJMJSZVRPZFFX-WLRTZDKTSA-N |
| XLogP | 2.01 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.08 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 178177294 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178177294?
The IUPAC name of CID 178177294 (CID 178177294) is not available.
What is the SMILES notation for CID 178177294?
The canonical SMILES for CID 178177294 is [B]c1ccc2ccn(/C(C=C)=C/C=C)c(=O)c2c1.
What is the InChIKey of CID 178177294?
The InChIKey is IVJMJSZVRPZFFX-WLRTZDKTSA-N. The full InChI is InChI=1S/C15H12BNO/c1-3-5-13(4-2)17-9-8-11-6-7-12(16)10-14(11)15(17)18/h3-10H,1-2H2/b13-5+.
What are the key properties of CID 178177294?
CID 178177294 has a molecular weight of 233.08 g/mol, XLogP of 2.01, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178177294 is sourced from PubChem (CID 178177294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).