C10H14N2O — CID 178177456
2-imino-N-[(4-methoxyphenyl)methyl]ethanamine (PubChem CID 178177456) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is 2-imino-N-[(4-methoxyphenyl)methyl]ethanamine.
| Compound Name | 2-imino-N-[(4-methoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 178177456 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 2-imino-N-[(4-methoxyphenyl)methyl]ethanamine |
| SMILES | [H]/N=C/CNCc1ccc(OC)cc1 |
| InChI | InChI=1S/C10H14N2O/c1-13-10-4-2-9(3-5-10)8-12-7-6-11/h2-6,11-12H,7-8H2,1H3/b11-6+ |
| InChIKey | RRKPGUYWUXRQFD-IZZDOVSWSA-N |
| XLogP | 1.43 |
| TPSA | 45.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|