About 2-[4-(2-chlorophenyl)phenyl]-1,4-oxazepan-3-one;methanamine
2-[4-(2-chlorophenyl)phenyl]-1,4-oxazepan-3-one;methanamine (PubChem CID 178178213) has the molecular formula C18H21ClN2O2
and a molecular weight of 332.83 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)phenyl]-1,4-oxazepan-3-one;methanamine.
Molecular Properties
| Compound Name | 2-[4-(2-chlorophenyl)phenyl]-1,4-oxazepan-3-one;methanamine |
| PubChem CID | 178178213 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-[4-(2-chlorophenyl)phenyl]-1,4-oxazepan-3-one;methanamine |
| SMILES | CN.O=C1NCCCOC1c1ccc(-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C17H16ClNO2.CH5N/c18-15-5-2-1-4-14(15)12-6-8-13(9-7-12)16-17(20)19-10-3-11-21-16;1-2/h1-2,4-9,16H,3,10-11H2,(H,19,20);2H2,1H3 |
| InChIKey | QTFWTRGAKZVSDW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(2-chlorophenyl)phenyl]-1,4-oxazepan-3-one;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-chlorophenyl)phenyl]-1,4-oxazepan-3-one;methanamine?
The IUPAC name of 2-[4-(2-chlorophenyl)phenyl]-1,4-oxazepan-3-one;methanamine (CID 178178213) is 2-[4-(2-chlorophenyl)phenyl]-1,4-oxazepan-3-one;methanamine.
What is the SMILES notation for 2-[4-(2-chlorophenyl)phenyl]-1,4-oxazepan-3-one;methanamine?
The canonical SMILES for 2-[4-(2-chlorophenyl)phenyl]-1,4-oxazepan-3-one;methanamine is CN.O=C1NCCCOC1c1ccc(-c2ccccc2Cl)cc1.
What is the InChIKey of 2-[4-(2-chlorophenyl)phenyl]-1,4-oxazepan-3-one;methanamine?
The InChIKey is QTFWTRGAKZVSDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClNO2.CH5N/c18-15-5-2-1-4-14(15)12-6-8-13(9-7-12)16-17(20)19-10-3-11-21-16;1-2/h1-2,4-9,16H,3,10-11H2,(H,19,20);2H2,1H3.
What are the key properties of 2-[4-(2-chlorophenyl)phenyl]-1,4-oxazepan-3-one;methanamine?
2-[4-(2-chlorophenyl)phenyl]-1,4-oxazepan-3-one;methanamine has a molecular weight of 332.83 g/mol, XLogP of 3.16, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-chlorophenyl)phenyl]-1,4-oxazepan-3-one;methanamine is sourced from PubChem (CID 178178213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).