About 1,3-difluoro-5-phenoxybenzene;methanamine;1,4-thiazepan-3-one
1,3-difluoro-5-phenoxybenzene;methanamine;1,4-thiazepan-3-one (PubChem CID 178178288) has the molecular formula C18H22F2N2O2S
and a molecular weight of 368.45 g/mol. Its IUPAC name is 1,3-difluoro-5-phenoxybenzene;methanamine;1,4-thiazepan-3-one.
Molecular Properties
| Compound Name | 1,3-difluoro-5-phenoxybenzene;methanamine;1,4-thiazepan-3-one |
| PubChem CID | 178178288 |
| Molecular Formula | C18H22F2N2O2S |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1,3-difluoro-5-phenoxybenzene;methanamine;1,4-thiazepan-3-one |
| SMILES | CN.Fc1cc(F)cc(Oc2ccccc2)c1.O=C1CSCCCN1 |
| InChI | InChI=1S/C12H8F2O.C5H9NOS.CH5N/c13-9-6-10(14)8-12(7-9)15-11-4-2-1-3-5-11;7-5-4-8-3-1-2-6-5;1-2/h1-8H;1-4H2,(H,6,7);2H2,1H3 |
| InChIKey | NNYOPDOPOXQWLM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-difluoro-5-phenoxybenzene;methanamine;1,4-thiazepan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-difluoro-5-phenoxybenzene;methanamine;1,4-thiazepan-3-one?
The IUPAC name of 1,3-difluoro-5-phenoxybenzene;methanamine;1,4-thiazepan-3-one (CID 178178288) is 1,3-difluoro-5-phenoxybenzene;methanamine;1,4-thiazepan-3-one.
What is the SMILES notation for 1,3-difluoro-5-phenoxybenzene;methanamine;1,4-thiazepan-3-one?
The canonical SMILES for 1,3-difluoro-5-phenoxybenzene;methanamine;1,4-thiazepan-3-one is CN.Fc1cc(F)cc(Oc2ccccc2)c1.O=C1CSCCCN1.
What is the InChIKey of 1,3-difluoro-5-phenoxybenzene;methanamine;1,4-thiazepan-3-one?
The InChIKey is NNYOPDOPOXQWLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F2O.C5H9NOS.CH5N/c13-9-6-10(14)8-12(7-9)15-11-4-2-1-3-5-11;7-5-4-8-3-1-2-6-5;1-2/h1-8H;1-4H2,(H,6,7);2H2,1H3.
What are the key properties of 1,3-difluoro-5-phenoxybenzene;methanamine;1,4-thiazepan-3-one?
1,3-difluoro-5-phenoxybenzene;methanamine;1,4-thiazepan-3-one has a molecular weight of 368.45 g/mol, XLogP of 3.57, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluoro-5-phenoxybenzene;methanamine;1,4-thiazepan-3-one is sourced from PubChem (CID 178178288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).