C23H36BFN2O4 — CID 178178923
tert-butyl (2R,6R)-4-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,6-dimethylpiperazine-1-carboxylate (PubChem CID 178178923) has the molecular formula C23H36BFN2O4 and a molecular weight of 434.36 g/mol. Its IUPAC name is tert-butyl (2R,6R)-4-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,6-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,6R)-4-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,6-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 178178923 |
| Molecular Formula | C23H36BFN2O4 |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | tert-butyl (2R,6R)-4-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,6-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2ccc(B3OC(C)(C)C(C)(C)O3)c(F)c2)C[C@@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H36BFN2O4/c1-15-13-26(14-16(2)27(15)20(28)29-21(3,4)5)17-10-11-18(19(25)12-17)24-30-22(6,7)23(8,9)31-24/h10-12,15-16H,13-14H2,1-9H3/t15-,16-/m1/s1 |
| InChIKey | UUJPIRDNGCTWDB-HZPDHXFCSA-N |
| XLogP | 3.96 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|