C17H15N3O3S — CID 178179092
2'-amino-3-hydroxyimino-7'-oxospiro[2H-indene-1,6'-4,5-dihydro-1-benzothiophene]-3'-carboxamide (PubChem CID 178179092) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is 2'-amino-3-hydroxyimino-7'-oxospiro[2H-indene-1,6'-4,5-dihydro-1-benzothiophene]-3'-carboxamide.
| Compound Name | 2'-amino-3-hydroxyimino-7'-oxospiro[2H-indene-1,6'-4,5-dihydro-1-benzothiophene]-3'-carboxamide |
|---|---|
| PubChem CID | 178179092 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 2'-amino-3-hydroxyimino-7'-oxospiro[2H-indene-1,6'-4,5-dihydro-1-benzothiophene]-3'-carboxamide |
| SMILES | NC(=O)c1c(N)sc2c1CCC1(CC(=NO)c3ccccc31)C2=O |
| InChI | InChI=1S/C17H15N3O3S/c18-15(22)12-9-5-6-17(14(21)13(9)24-16(12)19)7-11(20-23)8-3-1-2-4-10(8)17/h1-4,23H,5-7,19H2,(H2,18,22) |
| InChIKey | OGODPMCKCUICGW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|