About 3-(2-amino-3-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-N,N-dimethylbenzenesulfonamide
3-(2-amino-3-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-N,N-dimethylbenzenesulfonamide (PubChem CID 178179257) has the molecular formula C18H23N5O2S
and a molecular weight of 373.48 g/mol. Its IUPAC name is 3-(2-amino-3-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-N,N-dimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | 3-(2-amino-3-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-N,N-dimethylbenzenesulfonamide |
| PubChem CID | 178179257 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 3-(2-amino-3-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(-c2ccn3nc(N)c(C(C)(C)C)c3n2)c1 |
| InChI | InChI=1S/C18H23N5O2S/c1-18(2,3)15-16(19)21-23-10-9-14(20-17(15)23)12-7-6-8-13(11-12)26(24,25)22(4)5/h6-11H,1-5H3,(H2,19,21) |
| InChIKey | DYXKVNGUIYGSIO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 93.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(2-amino-3-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-N,N-dimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-3-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-N,N-dimethylbenzenesulfonamide?
The IUPAC name of 3-(2-amino-3-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-N,N-dimethylbenzenesulfonamide (CID 178179257) is 3-(2-amino-3-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-N,N-dimethylbenzenesulfonamide.
What is the SMILES notation for 3-(2-amino-3-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-N,N-dimethylbenzenesulfonamide?
The canonical SMILES for 3-(2-amino-3-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-N,N-dimethylbenzenesulfonamide is CN(C)S(=O)(=O)c1cccc(-c2ccn3nc(N)c(C(C)(C)C)c3n2)c1.
What is the InChIKey of 3-(2-amino-3-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-N,N-dimethylbenzenesulfonamide?
The InChIKey is DYXKVNGUIYGSIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N5O2S/c1-18(2,3)15-16(19)21-23-10-9-14(20-17(15)23)12-7-6-8-13(11-12)26(24,25)22(4)5/h6-11H,1-5H3,(H2,19,21).
What are the key properties of 3-(2-amino-3-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-N,N-dimethylbenzenesulfonamide?
3-(2-amino-3-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-N,N-dimethylbenzenesulfonamide has a molecular weight of 373.48 g/mol, XLogP of 2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-3-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-N,N-dimethylbenzenesulfonamide is sourced from PubChem (CID 178179257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).