C16H12FN3O4S — CID 178179703
6-(3-fluoro-4-methylanilino)-7-methylsulfonylquinoxaline-5,8-dione (PubChem CID 178179703) has the molecular formula C16H12FN3O4S and a molecular weight of 361.35 g/mol. Its IUPAC name is 6-(3-fluoro-4-methylanilino)-7-methylsulfonylquinoxaline-5,8-dione.
| Compound Name | 6-(3-fluoro-4-methylanilino)-7-methylsulfonylquinoxaline-5,8-dione |
|---|---|
| PubChem CID | 178179703 |
| Molecular Formula | C16H12FN3O4S |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 6-(3-fluoro-4-methylanilino)-7-methylsulfonylquinoxaline-5,8-dione |
| SMILES | Cc1ccc(NC2=C(S(C)(=O)=O)C(=O)c3nccnc3C2=O)cc1F |
| InChI | InChI=1S/C16H12FN3O4S/c1-8-3-4-9(7-10(8)17)20-13-14(21)11-12(19-6-5-18-11)15(22)16(13)25(2,23)24/h3-7,20H,1-2H3 |
| InChIKey | FPCXXQYJZLRONC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|