About N-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-N-fluorocyclopropanecarboxamide
N-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-N-fluorocyclopropanecarboxamide (PubChem CID 178180848) has the molecular formula C10H8ClFN4O
and a molecular weight of 254.65 g/mol. Its IUPAC name is N-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-N-fluorocyclopropanecarboxamide.
Molecular Properties
| Compound Name | N-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-N-fluorocyclopropanecarboxamide |
| PubChem CID | 178180848 |
| Molecular Formula | C10H8ClFN4O |
| Molecular Weight | 254.65 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | N-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-N-fluorocyclopropanecarboxamide |
| SMILES | O=C(C1CC1)N(F)c1cn2nc(Cl)ccc2n1 |
| InChI | InChI=1S/C10H8ClFN4O/c11-7-3-4-8-13-9(5-15(8)14-7)16(12)10(17)6-1-2-6/h3-6H,1-2H2 |
| InChIKey | ROZIQSHQLAXVEL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.65 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-N-fluorocyclopropanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-N-fluorocyclopropanecarboxamide?
The IUPAC name of N-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-N-fluorocyclopropanecarboxamide (CID 178180848) is N-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-N-fluorocyclopropanecarboxamide.
What is the SMILES notation for N-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-N-fluorocyclopropanecarboxamide?
The canonical SMILES for N-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-N-fluorocyclopropanecarboxamide is O=C(C1CC1)N(F)c1cn2nc(Cl)ccc2n1.
What is the InChIKey of N-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-N-fluorocyclopropanecarboxamide?
The InChIKey is ROZIQSHQLAXVEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClFN4O/c11-7-3-4-8-13-9(5-15(8)14-7)16(12)10(17)6-1-2-6/h3-6H,1-2H2.
What are the key properties of N-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-N-fluorocyclopropanecarboxamide?
N-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-N-fluorocyclopropanecarboxamide has a molecular weight of 254.65 g/mol, XLogP of 2.01, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-N-fluorocyclopropanecarboxamide is sourced from PubChem (CID 178180848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).