About CID 178181690
CID 178181690 (PubChem CID 178181690) has the molecular formula C4H9F2Si
and a molecular weight of 123.20 g/mol.
Molecular Properties
| Compound Name | CID 178181690 |
| PubChem CID | 178181690 |
| Molecular Formula | C4H9F2Si |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.04 |
| IUPAC Name | — |
| SMILES | CCC(C)[Si](F)F |
| InChI | InChI=1S/C4H9F2Si/c1-3-4(2)7(5)6/h4H,3H2,1-2H3 |
| InChIKey | VWMJIRLPSRHKCY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 178181690 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178181690?
The IUPAC name of CID 178181690 (CID 178181690) is not available.
What is the SMILES notation for CID 178181690?
The canonical SMILES for CID 178181690 is CCC(C)[Si](F)F.
What is the InChIKey of CID 178181690?
The InChIKey is VWMJIRLPSRHKCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9F2Si/c1-3-4(2)7(5)6/h4H,3H2,1-2H3.
What are the key properties of CID 178181690?
CID 178181690 has a molecular weight of 123.20 g/mol, XLogP of 2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178181690 is sourced from PubChem (CID 178181690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).