C50H54 — CID 178182217
1-[3,5-bis(3,5-ditert-butylphenyl)phenyl]pyrene (PubChem CID 178182217) has the molecular formula C50H54 and a molecular weight of 654.98 g/mol. Its IUPAC name is 1-[3,5-bis(3,5-ditert-butylphenyl)phenyl]pyrene.
| Compound Name | 1-[3,5-bis(3,5-ditert-butylphenyl)phenyl]pyrene |
|---|---|
| PubChem CID | 178182217 |
| Molecular Formula | C50H54 |
| Molecular Weight | 654.98 g/mol |
| Exact Mass | 654.42 |
| IUPAC Name | 1-[3,5-bis(3,5-ditert-butylphenyl)phenyl]pyrene |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cc(-c3ccc4ccc5cccc6ccc3c4c56)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C50H54/c1-47(2,3)39-25-36(26-40(29-39)48(4,5)6)34-22-35(37-27-41(49(7,8)9)30-42(28-37)50(10,11)12)24-38(23-34)43-20-18-33-17-16-31-14-13-15-32-19-21-44(43)46(33)45(31)32/h13-30H,1-12H3 |
| InChIKey | HXXNQGJTISCNFV-UHFFFAOYSA-N |
| XLogP | 14.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.98 |
| LogP ≤ 5 | 14.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|