About 2-bromoiodanuidyl-3-cyclopropylimidazo[1,2-a]pyridine
2-bromoiodanuidyl-3-cyclopropylimidazo[1,2-a]pyridine (PubChem CID 178182334) has the molecular formula C10H9BrIN2-
and a molecular weight of 364.00 g/mol. Its IUPAC name is 2-bromoiodanuidyl-3-cyclopropylimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2-bromoiodanuidyl-3-cyclopropylimidazo[1,2-a]pyridine |
| PubChem CID | 178182334 |
| Molecular Formula | C10H9BrIN2- |
| Molecular Weight | 364.00 g/mol |
| Exact Mass | 362.90 |
| IUPAC Name | 2-bromoiodanuidyl-3-cyclopropylimidazo[1,2-a]pyridine |
| SMILES | Br[I-]c1nc2ccccn2c1C1CC1 |
| InChI | InChI=1S/C10H9BrIN2/c11-12-10-9(7-4-5-7)14-6-2-1-3-8(14)13-10/h1-3,6-7H,4-5H2/q-1 |
| InChIKey | QPDULGAJOWRRKJ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.00 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoiodanuidyl-3-cyclopropylimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoiodanuidyl-3-cyclopropylimidazo[1,2-a]pyridine?
The IUPAC name of 2-bromoiodanuidyl-3-cyclopropylimidazo[1,2-a]pyridine (CID 178182334) is 2-bromoiodanuidyl-3-cyclopropylimidazo[1,2-a]pyridine.
What is the SMILES notation for 2-bromoiodanuidyl-3-cyclopropylimidazo[1,2-a]pyridine?
The canonical SMILES for 2-bromoiodanuidyl-3-cyclopropylimidazo[1,2-a]pyridine is Br[I-]c1nc2ccccn2c1C1CC1.
What is the InChIKey of 2-bromoiodanuidyl-3-cyclopropylimidazo[1,2-a]pyridine?
The InChIKey is QPDULGAJOWRRKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrIN2/c11-12-10-9(7-4-5-7)14-6-2-1-3-8(14)13-10/h1-3,6-7H,4-5H2/q-1.
What are the key properties of 2-bromoiodanuidyl-3-cyclopropylimidazo[1,2-a]pyridine?
2-bromoiodanuidyl-3-cyclopropylimidazo[1,2-a]pyridine has a molecular weight of 364.00 g/mol, XLogP of -0.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoiodanuidyl-3-cyclopropylimidazo[1,2-a]pyridine is sourced from PubChem (CID 178182334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).