C37H27N3Na2O9S3 — CID 178182865
disodium;2-[4-[[4-(2-sulfonatoanilino)phenyl]-[4-(2-sulfophenyl)iminocyclohexa-2,5-dien-1-ylidene]methyl]anilino]benzenesulfonate (PubChem CID 178182865) has the molecular formula C37H27N3Na2O9S3 and a molecular weight of 799.82 g/mol. Its IUPAC name is disodium;2-[4-[[4-(2-sulfonatoanilino)phenyl]-[4-(2-sulfophenyl)iminocyclohexa-2,5-dien-1-ylidene]methyl]anilino]benzenesulfonate.
| Compound Name | disodium;2-[4-[[4-(2-sulfonatoanilino)phenyl]-[4-(2-sulfophenyl)iminocyclohexa-2,5-dien-1-ylidene]methyl]anilino]benzenesulfonate |
|---|---|
| PubChem CID | 178182865 |
| Molecular Formula | C37H27N3Na2O9S3 |
| Molecular Weight | 799.82 g/mol |
| Exact Mass | 799.07 |
| IUPAC Name | disodium;2-[4-[[4-(2-sulfonatoanilino)phenyl]-[4-(2-sulfophenyl)iminocyclohexa-2,5-dien-1-ylidene]methyl]anilino]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccccc1Nc1ccc(C(=C2C=CC(=Nc3ccccc3S(=O)(=O)O)C=C2)c2ccc(Nc3ccccc3S(=O)(=O)[O-])cc2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C37H29N3O9S3.2Na/c41-50(42,43)34-10-4-1-7-31(34)38-28-19-13-25(14-20-28)37(26-15-21-29(22-16-26)39-32-8-2-5-11-35(32)51(44,45)46)27-17-23-30(24-18-27)40-33-9-3-6-12-36(33)52(47,48)49;;/h1-24,38-39H,(H,41,42,43)(H,44,45,46)(H,47,48,49);;/q;2*+1/p-2 |
| InChIKey | TUHAIJABPUJAEY-UHFFFAOYSA-L |
| XLogP | 0.94 |
| TPSA | 205.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.82 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|