C27H27BFNO4 — CID 178183320
1-[3-[3-(4-fluorophenyl)phenyl]phenyl]-4,4,5,6,6-pentamethyl-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione (PubChem CID 178183320) has the molecular formula C27H27BFNO4 and a molecular weight of 459.33 g/mol. Its IUPAC name is 1-[3-[3-(4-fluorophenyl)phenyl]phenyl]-4,4,5,6,6-pentamethyl-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione.
| Compound Name | 1-[3-[3-(4-fluorophenyl)phenyl]phenyl]-4,4,5,6,6-pentamethyl-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione |
|---|---|
| PubChem CID | 178183320 |
| Molecular Formula | C27H27BFNO4 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 1-[3-[3-(4-fluorophenyl)phenyl]phenyl]-4,4,5,6,6-pentamethyl-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione |
| SMILES | CC1(C)C(=O)O[B-]2(c3cccc(-c4cccc(-c5ccc(F)cc5)c4)c3)OC(=O)C(C)(C)[N+]21C |
| InChI | InChI=1S/C27H27BFNO4/c1-26(2)24(31)33-28(30(26,5)27(3,4)25(32)34-28)22-11-7-10-21(17-22)20-9-6-8-19(16-20)18-12-14-23(29)15-13-18/h6-17H,1-5H3 |
| InChIKey | PEISNQDKPFCVJZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|