C21H22BF2NO4 — CID 178183332
1-[3-(2,4-difluorophenyl)phenyl]-4,4,5,6,6-pentamethyl-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione (PubChem CID 178183332) has the molecular formula C21H22BF2NO4 and a molecular weight of 401.22 g/mol. Its IUPAC name is 1-[3-(2,4-difluorophenyl)phenyl]-4,4,5,6,6-pentamethyl-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione.
| Compound Name | 1-[3-(2,4-difluorophenyl)phenyl]-4,4,5,6,6-pentamethyl-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione |
|---|---|
| PubChem CID | 178183332 |
| Molecular Formula | C21H22BF2NO4 |
| Molecular Weight | 401.22 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 1-[3-(2,4-difluorophenyl)phenyl]-4,4,5,6,6-pentamethyl-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione |
| SMILES | CC1(C)C(=O)O[B-]2(c3cccc(-c4ccc(F)cc4F)c3)OC(=O)C(C)(C)[N+]21C |
| InChI | InChI=1S/C21H22BF2NO4/c1-20(2)18(26)28-22(25(20,5)21(3,4)19(27)29-22)14-8-6-7-13(11-14)16-10-9-15(23)12-17(16)24/h6-12H,1-5H3 |
| InChIKey | OOWKFIHJFZUUJR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|