C22H27F3N2O2 — CID 178183404
N-benzyl-2-[(E)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino]oxyethanamine (PubChem CID 178183404) has the molecular formula C22H27F3N2O2 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-benzyl-2-[(E)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino]oxyethanamine.
| Compound Name | N-benzyl-2-[(E)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino]oxyethanamine |
|---|---|
| PubChem CID | 178183404 |
| Molecular Formula | C22H27F3N2O2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-benzyl-2-[(E)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino]oxyethanamine |
| SMILES | COCCCC/C(=N\OCCNCc1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H27F3N2O2/c1-28-15-6-5-9-21(19-10-12-20(13-11-19)22(23,24)25)27-29-16-14-26-17-18-7-3-2-4-8-18/h2-4,7-8,10-13,26H,5-6,9,14-17H2,1H3/b27-21+ |
| InChIKey | IOHQMKFHRKXLTO-SZXQPVLSSA-N |
| XLogP | 5.03 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|