C27H36ClN — CID 178183415
N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-1-(4-chlorophenyl)methanamine (PubChem CID 178183415) has the molecular formula C27H36ClN and a molecular weight of 410.05 g/mol. Its IUPAC name is N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-1-(4-chlorophenyl)methanamine.
| Compound Name | N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-1-(4-chlorophenyl)methanamine |
|---|---|
| PubChem CID | 178183415 |
| Molecular Formula | C27H36ClN |
| Molecular Weight | 410.05 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-1-(4-chlorophenyl)methanamine |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@](C)(CNCc3ccc(Cl)cc3)CCC[C@]21C |
| InChI | InChI=1S/C27H36ClN/c1-19(2)21-8-12-24-22(16-21)9-13-25-26(3,14-5-15-27(24,25)4)18-29-17-20-6-10-23(28)11-7-20/h6-8,10-12,16,19,25,29H,5,9,13-15,17-18H2,1-4H3/t25-,26-,27+/m0/s1 |
| InChIKey | UNWILNPMWPLQOP-GMQQYTKMSA-N |
| XLogP | 7.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.05 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |