About 5-(3,4-dimethylphenyl)-3-methoxypyrazin-2-amine
5-(3,4-dimethylphenyl)-3-methoxypyrazin-2-amine (PubChem CID 178183758) has the molecular formula C13H15N3O
and a molecular weight of 229.28 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-3-methoxypyrazin-2-amine.
Molecular Properties
| Compound Name | 5-(3,4-dimethylphenyl)-3-methoxypyrazin-2-amine |
| PubChem CID | 178183758 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-3-methoxypyrazin-2-amine |
| SMILES | COc1nc(-c2ccc(C)c(C)c2)cnc1N |
| InChI | InChI=1S/C13H15N3O/c1-8-4-5-10(6-9(8)2)11-7-15-12(14)13(16-11)17-3/h4-7H,1-3H3,(H2,14,15) |
| InChIKey | LTFCEGACYPIUME-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3,4-dimethylphenyl)-3-methoxypyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethylphenyl)-3-methoxypyrazin-2-amine?
The IUPAC name of 5-(3,4-dimethylphenyl)-3-methoxypyrazin-2-amine (CID 178183758) is 5-(3,4-dimethylphenyl)-3-methoxypyrazin-2-amine.
What is the SMILES notation for 5-(3,4-dimethylphenyl)-3-methoxypyrazin-2-amine?
The canonical SMILES for 5-(3,4-dimethylphenyl)-3-methoxypyrazin-2-amine is COc1nc(-c2ccc(C)c(C)c2)cnc1N.
What is the InChIKey of 5-(3,4-dimethylphenyl)-3-methoxypyrazin-2-amine?
The InChIKey is LTFCEGACYPIUME-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O/c1-8-4-5-10(6-9(8)2)11-7-15-12(14)13(16-11)17-3/h4-7H,1-3H3,(H2,14,15).
What are the key properties of 5-(3,4-dimethylphenyl)-3-methoxypyrazin-2-amine?
5-(3,4-dimethylphenyl)-3-methoxypyrazin-2-amine has a molecular weight of 229.28 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethylphenyl)-3-methoxypyrazin-2-amine is sourced from PubChem (CID 178183758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).