C14H25NO5S2 — CID 178183846
methyl (3S)-4-[2,2-dimethylpropyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxo-3-sulfanylbutanoate (PubChem CID 178183846) has the molecular formula C14H25NO5S2 and a molecular weight of 351.49 g/mol. Its IUPAC name is methyl (3S)-4-[2,2-dimethylpropyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxo-3-sulfanylbutanoate.
| Compound Name | methyl (3S)-4-[2,2-dimethylpropyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxo-3-sulfanylbutanoate |
|---|---|
| PubChem CID | 178183846 |
| Molecular Formula | C14H25NO5S2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | methyl (3S)-4-[2,2-dimethylpropyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-4-oxo-3-sulfanylbutanoate |
| SMILES | COC(=O)C[C@H](S)C(=O)N(CC(C)(C)C)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H25NO5S2/c1-14(2,3)9-15(10-5-6-22(18,19)8-10)13(17)11(21)7-12(16)20-4/h10-11,21H,5-9H2,1-4H3/t10-,11-/m0/s1 |
| InChIKey | MGNYDPFDODURGV-QWRGUYRKSA-N |
| XLogP | 0.91 |
| TPSA | 80.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|