About CID 178184622
CID 178184622 (PubChem CID 178184622) has the molecular formula C33H55O13Si
and a molecular weight of 687.88 g/mol.
Molecular Properties
| Compound Name | CID 178184622 |
| PubChem CID | 178184622 |
| Molecular Formula | C33H55O13Si |
| Molecular Weight | 687.88 g/mol |
| Exact Mass | 687.34 |
| IUPAC Name | — |
| SMILES | CO[C@@]12CC[C@H](CCOC(=O)C(C)(C)C)O[C@@H]1[C@@H](OC(C)=O)[C@@H]1O[C@H](C[C@H](COC(C)=O)OC(C)=O)[C@H](O[Si](C(C)C)C(C)C)[C@@H]1O2 |
| InChI | InChI=1S/C33H55O13Si/c1-18(2)47(19(3)4)46-26-25(16-24(41-21(6)35)17-40-20(5)34)44-27-28(26)45-33(38-11)14-12-23(13-15-39-31(37)32(8,9)10)43-30(33)29(27)42-22(7)36/h18-19,23-30H,12-17H2,1-11H3/t23-,24-,25-,26+,27-,28+,29+,30-,33-/m1/s1 |
| InChIKey | MLPQEVSHOPWTTP-UXIVSEQISA-N |
| XLogP | 4.04 |
| TPSA | 151.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 687.88 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 178184622 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178184622?
The IUPAC name of CID 178184622 (CID 178184622) is not available.
What is the SMILES notation for CID 178184622?
The canonical SMILES for CID 178184622 is CO[C@@]12CC[C@H](CCOC(=O)C(C)(C)C)O[C@@H]1[C@@H](OC(C)=O)[C@@H]1O[C@H](C[C@H](COC(C)=O)OC(C)=O)[C@H](O[Si](C(C)C)C(C)C)[C@@H]1O2.
What is the InChIKey of CID 178184622?
The InChIKey is MLPQEVSHOPWTTP-UXIVSEQISA-N. The full InChI is InChI=1S/C33H55O13Si/c1-18(2)47(19(3)4)46-26-25(16-24(41-21(6)35)17-40-20(5)34)44-27-28(26)45-33(38-11)14-12-23(13-15-39-31(37)32(8,9)10)43-30(33)29(27)42-22(7)36/h18-19,23-30H,12-17H2,1-11H3/t23-,24-,25-,26+,27-,28+,29+,30-,33-/m1/s1.
What are the key properties of CID 178184622?
CID 178184622 has a molecular weight of 687.88 g/mol, XLogP of 4.04, 14 rotatable bonds, 0 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178184622 is sourced from PubChem (CID 178184622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).