C26H46O6Si — CID 178184627
(E)-3-[(2S,3S)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]prop-2-en-1-ol (PubChem CID 178184627) has the molecular formula C26H46O6Si and a molecular weight of 482.73 g/mol. Its IUPAC name is (E)-3-[(2S,3S)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]prop-2-en-1-ol.
| Compound Name | (E)-3-[(2S,3S)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 178184627 |
| Molecular Formula | C26H46O6Si |
| Molecular Weight | 482.73 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | (E)-3-[(2S,3S)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-triethylsilyloxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]prop-2-en-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@H]1OC2(CCCCC2)O[C@H]1/C=C/CO)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C26H46O6Si/c1-4-33(5-2,6-3)32-24(22-20-28-25(30-22)15-9-7-10-16-25)23-21(14-13-19-27)29-26(31-23)17-11-8-12-18-26/h13-14,21-24,27H,4-12,15-20H2,1-3H3/b14-13+/t21-,22+,23-,24-/m0/s1 |
| InChIKey | FEICIJITMPWEEA-ZPUUTNPYSA-N |
| XLogP | 5.45 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.73 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|