C21H32O6 — CID 178184629
(3aR,4S,6S,7S,7aS)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-6-ethenylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-ol (PubChem CID 178184629) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is (3aR,4S,6S,7S,7aS)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-6-ethenylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-ol.
| Compound Name | (3aR,4S,6S,7S,7aS)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-6-ethenylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-ol |
|---|---|
| PubChem CID | 178184629 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (3aR,4S,6S,7S,7aS)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-6-ethenylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-ol |
| SMILES | C=C[C@@H]1O[C@@H]([C@H]2COC3(CCCCC3)O2)[C@H]2OC3(CCCCC3)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C21H32O6/c1-2-14-16(22)18-19(27-21(26-18)11-7-4-8-12-21)17(24-14)15-13-23-20(25-15)9-5-3-6-10-20/h2,14-19,22H,1,3-13H2/t14-,15+,16-,17-,18-,19+/m0/s1 |
| InChIKey | HCMFQXGWUYDTOL-CABLIKTCSA-N |
| XLogP | 2.82 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|