C34H62O6SSi2 — CID 178184716
2-[(2S,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxy-3-(phenylsulfanylmethyl)oxolan-2-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 178184716) has the molecular formula C34H62O6SSi2 and a molecular weight of 655.10 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxy-3-(phenylsulfanylmethyl)oxolan-2-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(2S,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxy-3-(phenylsulfanylmethyl)oxolan-2-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 178184716 |
| Molecular Formula | C34H62O6SSi2 |
| Molecular Weight | 655.10 g/mol |
| Exact Mass | 654.38 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxy-3-(phenylsulfanylmethyl)oxolan-2-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CO[C@@H]1[C@@H](CSc2ccccc2)[C@H](CCOC(=O)C(C)(C)C)O[C@@H]1C[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H62O6SSi2/c1-32(2,3)31(35)37-21-20-28-27(24-41-26-18-16-15-17-19-26)30(36-10)29(39-28)22-25(40-43(13,14)34(7,8)9)23-38-42(11,12)33(4,5)6/h15-19,25,27-30H,20-24H2,1-14H3/t25-,27-,28-,29+,30+/m0/s1 |
| InChIKey | VZBGYYUKQKUSFG-YVZPFGSISA-N |
| XLogP | 8.96 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.10 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|