C21H27IO5S — CID 178184719
[(2R,3aR,5R,7aS)-2-[2-(benzenesulfonyl)ethyl]-5-(2-methylbuta-2,3-dienyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3a-yl]methyl hypoiodite (PubChem CID 178184719) has the molecular formula C21H27IO5S and a molecular weight of 518.41 g/mol. Its IUPAC name is [(2R,3aR,5R,7aS)-2-[2-(benzenesulfonyl)ethyl]-5-(2-methylbuta-2,3-dienyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3a-yl]methyl hypoiodite.
| Compound Name | [(2R,3aR,5R,7aS)-2-[2-(benzenesulfonyl)ethyl]-5-(2-methylbuta-2,3-dienyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3a-yl]methyl hypoiodite |
|---|---|
| PubChem CID | 178184719 |
| Molecular Formula | C21H27IO5S |
| Molecular Weight | 518.41 g/mol |
| Exact Mass | 518.06 |
| IUPAC Name | [(2R,3aR,5R,7aS)-2-[2-(benzenesulfonyl)ethyl]-5-(2-methylbuta-2,3-dienyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3a-yl]methyl hypoiodite |
| SMILES | C=C=C(C)C[C@H]1CC[C@@H]2O[C@@H](CCS(=O)(=O)c3ccccc3)C[C@]2(COI)O1 |
| InChI | InChI=1S/C21H27IO5S/c1-3-16(2)13-17-9-10-20-21(27-17,15-25-22)14-18(26-20)11-12-28(23,24)19-7-5-4-6-8-19/h4-8,17-18,20H,1,9-15H2,2H3/t17-,18+,20+,21-/m1/s1 |
| InChIKey | XIDYZYOYFYLXHF-YXYSEUPNSA-N |
| XLogP | 4.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|