C26H32N8OS — CID 178184907
2-[4-[(2S,5R)-2,5-diethyl-4-[(1R)-1-(2-methyl-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-methyl-2-oxopyrazolo[1,5-a][1,3,5]triazin-7-yl]acetonitrile (PubChem CID 178184907) has the molecular formula C26H32N8OS and a molecular weight of 504.66 g/mol. Its IUPAC name is 2-[4-[(2S,5R)-2,5-diethyl-4-[(1R)-1-(2-methyl-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-methyl-2-oxopyrazolo[1,5-a][1,3,5]triazin-7-yl]acetonitrile.
| Compound Name | 2-[4-[(2S,5R)-2,5-diethyl-4-[(1R)-1-(2-methyl-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-methyl-2-oxopyrazolo[1,5-a][1,3,5]triazin-7-yl]acetonitrile |
|---|---|
| PubChem CID | 178184907 |
| Molecular Formula | C26H32N8OS |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 2-[4-[(2S,5R)-2,5-diethyl-4-[(1R)-1-(2-methyl-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-methyl-2-oxopyrazolo[1,5-a][1,3,5]triazin-7-yl]acetonitrile |
| SMILES | CC[C@H]1CN([C@H](C)c2ccc3nc(C)sc3c2)[C@H](CC)CN1c1nc(=O)n(C)c2cc(CC#N)nn12 |
| InChI | InChI=1S/C26H32N8OS/c1-6-20-15-33(25-29-26(35)31(5)24-13-19(10-11-27)30-34(24)25)21(7-2)14-32(20)16(3)18-8-9-22-23(12-18)36-17(4)28-22/h8-9,12-13,16,20-21H,6-7,10,14-15H2,1-5H3/t16-,20-,21+/m1/s1 |
| InChIKey | ALCNQMYYMWOQST-HBGVWJBISA-N |
| XLogP | 3.85 |
| TPSA | 95.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |