C29H28ClF3N6O2 — CID 178185043
(Z)-1-[7-[4-amino-6-(trifluoromethyl)pyridine-3-carbonyl]-3-(4-cyclobutylphenyl)-2,3,7,10-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13)-dien-10-yl]-3-chloroprop-2-en-1-one (PubChem CID 178185043) has the molecular formula C29H28ClF3N6O2 and a molecular weight of 585.03 g/mol. Its IUPAC name is (Z)-1-[7-[4-amino-6-(trifluoromethyl)pyridine-3-carbonyl]-3-(4-cyclobutylphenyl)-2,3,7,10-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13)-dien-10-yl]-3-chloroprop-2-en-1-one.
| Compound Name | (Z)-1-[7-[4-amino-6-(trifluoromethyl)pyridine-3-carbonyl]-3-(4-cyclobutylphenyl)-2,3,7,10-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13)-dien-10-yl]-3-chloroprop-2-en-1-one |
|---|---|
| PubChem CID | 178185043 |
| Molecular Formula | C29H28ClF3N6O2 |
| Molecular Weight | 585.03 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | (Z)-1-[7-[4-amino-6-(trifluoromethyl)pyridine-3-carbonyl]-3-(4-cyclobutylphenyl)-2,3,7,10-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13)-dien-10-yl]-3-chloroprop-2-en-1-one |
| SMILES | Nc1cc(C(F)(F)F)ncc1C(=O)N1CCc2c3c(nn2-c2ccc(C4CCC4)cc2)CCN(C(=O)/C=C\Cl)CC31 |
| InChI | InChI=1S/C29H28ClF3N6O2/c30-11-8-26(40)37-12-9-22-27-23(39(36-22)19-6-4-18(5-7-19)17-2-1-3-17)10-13-38(24(27)16-37)28(41)20-15-35-25(14-21(20)34)29(31,32)33/h4-8,11,14-15,17,24H,1-3,9-10,12-13,16H2,(H2,34,35)/b11-8- |
| InChIKey | VVCNOBSUAURIJR-FLIBITNWSA-N |
| XLogP | 5.01 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.03 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|