C23H21Cl2N3O5 — CID 178185054
(3,5-dichlorophenyl)methyl (3aS,7aR)-2-(2-oxo-3H-1,3-benzoxazole-6-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate (PubChem CID 178185054) has the molecular formula C23H21Cl2N3O5 and a molecular weight of 490.34 g/mol. Its IUPAC name is (3,5-dichlorophenyl)methyl (3aS,7aR)-2-(2-oxo-3H-1,3-benzoxazole-6-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate.
| Compound Name | (3,5-dichlorophenyl)methyl (3aS,7aR)-2-(2-oxo-3H-1,3-benzoxazole-6-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 178185054 |
| Molecular Formula | C23H21Cl2N3O5 |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | (3,5-dichlorophenyl)methyl (3aS,7aR)-2-(2-oxo-3H-1,3-benzoxazole-6-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate |
| SMILES | O=C(OCc1cc(Cl)cc(Cl)c1)N1CC[C@H]2CN(C(=O)c3ccc4[nH]c(=O)oc4c3)C[C@H]2C1 |
| InChI | InChI=1S/C23H21Cl2N3O5/c24-17-5-13(6-18(25)8-17)12-32-23(31)27-4-3-15-9-28(11-16(15)10-27)21(29)14-1-2-19-20(7-14)33-22(30)26-19/h1-2,5-8,15-16H,3-4,9-12H2,(H,26,30)/t15-,16+/m0/s1 |
| InChIKey | ZRNBBRKTIMLWGP-JKSUJKDBSA-N |
| XLogP | 4.16 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |