About (3S,4R)-3-(2,3-dihydroindol-1-yl)-4-prop-2-enyloxan-4-ol
(3S,4R)-3-(2,3-dihydroindol-1-yl)-4-prop-2-enyloxan-4-ol (PubChem CID 178185674) has the molecular formula C16H21NO2
and a molecular weight of 259.35 g/mol. Its IUPAC name is (3S,4R)-3-(2,3-dihydroindol-1-yl)-4-prop-2-enyloxan-4-ol.
Molecular Properties
| Compound Name | (3S,4R)-3-(2,3-dihydroindol-1-yl)-4-prop-2-enyloxan-4-ol |
| PubChem CID | 178185674 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (3S,4R)-3-(2,3-dihydroindol-1-yl)-4-prop-2-enyloxan-4-ol |
| SMILES | C=CC[C@@]1(O)CCOC[C@@H]1N1CCc2ccccc21 |
| InChI | InChI=1S/C16H21NO2/c1-2-8-16(18)9-11-19-12-15(16)17-10-7-13-5-3-4-6-14(13)17/h2-6,15,18H,1,7-12H2/t15-,16+/m0/s1 |
| InChIKey | PWPHOPCOTLGSQG-JKSUJKDBSA-N |
| XLogP | 2.15 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,4R)-3-(2,3-dihydroindol-1-yl)-4-prop-2-enyloxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-3-(2,3-dihydroindol-1-yl)-4-prop-2-enyloxan-4-ol?
The IUPAC name of (3S,4R)-3-(2,3-dihydroindol-1-yl)-4-prop-2-enyloxan-4-ol (CID 178185674) is (3S,4R)-3-(2,3-dihydroindol-1-yl)-4-prop-2-enyloxan-4-ol.
What is the SMILES notation for (3S,4R)-3-(2,3-dihydroindol-1-yl)-4-prop-2-enyloxan-4-ol?
The canonical SMILES for (3S,4R)-3-(2,3-dihydroindol-1-yl)-4-prop-2-enyloxan-4-ol is C=CC[C@@]1(O)CCOC[C@@H]1N1CCc2ccccc21.
What is the InChIKey of (3S,4R)-3-(2,3-dihydroindol-1-yl)-4-prop-2-enyloxan-4-ol?
The InChIKey is PWPHOPCOTLGSQG-JKSUJKDBSA-N. The full InChI is InChI=1S/C16H21NO2/c1-2-8-16(18)9-11-19-12-15(16)17-10-7-13-5-3-4-6-14(13)17/h2-6,15,18H,1,7-12H2/t15-,16+/m0/s1.
What are the key properties of (3S,4R)-3-(2,3-dihydroindol-1-yl)-4-prop-2-enyloxan-4-ol?
(3S,4R)-3-(2,3-dihydroindol-1-yl)-4-prop-2-enyloxan-4-ol has a molecular weight of 259.35 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-3-(2,3-dihydroindol-1-yl)-4-prop-2-enyloxan-4-ol is sourced from PubChem (CID 178185674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).