About CID 178186121
CID 178186121 (PubChem CID 178186121) has the molecular formula C13H10NO
and a molecular weight of 196.23 g/mol.
Molecular Properties
| Compound Name | CID 178186121 |
| PubChem CID | 178186121 |
| Molecular Formula | C13H10NO |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | — |
| SMILES | Oc1cccc2c1=C1NC=CC=C1[CH]C=2 |
| InChI | InChI=1S/C13H10NO/c15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11/h1-8,14-15H |
| InChIKey | UCBIJEFPFKTJDF-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 178186121 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178186121?
The IUPAC name of CID 178186121 (CID 178186121) is not available.
What is the SMILES notation for CID 178186121?
The canonical SMILES for CID 178186121 is Oc1cccc2c1=C1NC=CC=C1[CH]C=2.
What is the InChIKey of CID 178186121?
The InChIKey is UCBIJEFPFKTJDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10NO/c15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11/h1-8,14-15H.
What are the key properties of CID 178186121?
CID 178186121 has a molecular weight of 196.23 g/mol, XLogP of 0.54, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178186121 is sourced from PubChem (CID 178186121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).