About 2-amino-4-fluoro-4,5-dihydro-1H-pyrimidin-6-one
2-amino-4-fluoro-4,5-dihydro-1H-pyrimidin-6-one (PubChem CID 178186153) has the molecular formula C4H6FN3O
and a molecular weight of 131.11 g/mol. Its IUPAC name is 2-amino-4-fluoro-4,5-dihydro-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-amino-4-fluoro-4,5-dihydro-1H-pyrimidin-6-one |
| PubChem CID | 178186153 |
| Molecular Formula | C4H6FN3O |
| Molecular Weight | 131.11 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | 2-amino-4-fluoro-4,5-dihydro-1H-pyrimidin-6-one |
| SMILES | NC1=NC(F)CC(=O)N1 |
| InChI | InChI=1S/C4H6FN3O/c5-2-1-3(9)8-4(6)7-2/h2H,1H2,(H3,6,7,8,9) |
| InChIKey | PGALIVRDVZOTMI-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.11 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-fluoro-4,5-dihydro-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-fluoro-4,5-dihydro-1H-pyrimidin-6-one?
The IUPAC name of 2-amino-4-fluoro-4,5-dihydro-1H-pyrimidin-6-one (CID 178186153) is 2-amino-4-fluoro-4,5-dihydro-1H-pyrimidin-6-one.
What is the SMILES notation for 2-amino-4-fluoro-4,5-dihydro-1H-pyrimidin-6-one?
The canonical SMILES for 2-amino-4-fluoro-4,5-dihydro-1H-pyrimidin-6-one is NC1=NC(F)CC(=O)N1.
What is the InChIKey of 2-amino-4-fluoro-4,5-dihydro-1H-pyrimidin-6-one?
The InChIKey is PGALIVRDVZOTMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6FN3O/c5-2-1-3(9)8-4(6)7-2/h2H,1H2,(H3,6,7,8,9).
What are the key properties of 2-amino-4-fluoro-4,5-dihydro-1H-pyrimidin-6-one?
2-amino-4-fluoro-4,5-dihydro-1H-pyrimidin-6-one has a molecular weight of 131.11 g/mol, XLogP of -0.88, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-fluoro-4,5-dihydro-1H-pyrimidin-6-one is sourced from PubChem (CID 178186153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).