C27H29N3O3 — CID 178186620
5-(4-ethoxyphenyl)-8-[(4-methylphenyl)methyl]-12,14-dioxa-3,4,8-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),9,11(15)-triene (PubChem CID 178186620) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 5-(4-ethoxyphenyl)-8-[(4-methylphenyl)methyl]-12,14-dioxa-3,4,8-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),9,11(15)-triene.
| Compound Name | 5-(4-ethoxyphenyl)-8-[(4-methylphenyl)methyl]-12,14-dioxa-3,4,8-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),9,11(15)-triene |
|---|---|
| PubChem CID | 178186620 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 5-(4-ethoxyphenyl)-8-[(4-methylphenyl)methyl]-12,14-dioxa-3,4,8-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),9,11(15)-triene |
| SMILES | CCOc1ccc(C2NNC3c4cc5c(cc4N(Cc4ccc(C)cc4)CC23)OCO5)cc1 |
| InChI | InChI=1S/C27H29N3O3/c1-3-31-20-10-8-19(9-11-20)26-22-15-30(14-18-6-4-17(2)5-7-18)23-13-25-24(32-16-33-25)12-21(23)27(22)29-28-26/h4-13,22,26-29H,3,14-16H2,1-2H3 |
| InChIKey | CRKBIWOIEQUAFW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 54.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|