C22H24N2O5 — CID 178187305
(E)-3-(3,4-dimethoxyphenyl)-N-[1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]prop-2-enamide (PubChem CID 178187305) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 178187305 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]prop-2-enamide |
| SMILES | COc1ccc(N2CC(NC(=O)/C=C/c3ccc(OC)c(OC)c3)CC2=O)cc1 |
| InChI | InChI=1S/C22H24N2O5/c1-27-18-8-6-17(7-9-18)24-14-16(13-22(24)26)23-21(25)11-5-15-4-10-19(28-2)20(12-15)29-3/h4-12,16H,13-14H2,1-3H3,(H,23,25)/b11-5+ |
| InChIKey | QHRZUOLNZPLXOL-VZUCSPMQSA-N |
| XLogP | 2.65 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|