C19H26N4O3S — CID 178188188
N-(3-methylsulfanylphenyl)-3-oxo-5-(oxolan-2-ylmethyl)-2,3a,4,6,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridine-7-carboxamide (PubChem CID 178188188) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is N-(3-methylsulfanylphenyl)-3-oxo-5-(oxolan-2-ylmethyl)-2,3a,4,6,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridine-7-carboxamide.
| Compound Name | N-(3-methylsulfanylphenyl)-3-oxo-5-(oxolan-2-ylmethyl)-2,3a,4,6,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 178188188 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-(3-methylsulfanylphenyl)-3-oxo-5-(oxolan-2-ylmethyl)-2,3a,4,6,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridine-7-carboxamide |
| SMILES | CSc1cccc(NC(=O)C2CN(CC3CCCO3)CC3C(=O)NNC32)c1 |
| InChI | InChI=1S/C19H26N4O3S/c1-27-14-6-2-4-12(8-14)20-18(24)15-10-23(9-13-5-3-7-26-13)11-16-17(15)21-22-19(16)25/h2,4,6,8,13,15-17,21H,3,5,7,9-11H2,1H3,(H,20,24)(H,22,25) |
| InChIKey | IFCQMWUYDMUIJD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |