C8H12ClN3O3 — CID 178188651
7-chloro-8-methoxy-4a,5,6,7,8,8a-hexahydro-1H-pyrido[4,3-d]pyrimidine-2,4-dione (PubChem CID 178188651) has the molecular formula C8H12ClN3O3 and a molecular weight of 233.66 g/mol. Its IUPAC name is 7-chloro-8-methoxy-4a,5,6,7,8,8a-hexahydro-1H-pyrido[4,3-d]pyrimidine-2,4-dione.
| Compound Name | 7-chloro-8-methoxy-4a,5,6,7,8,8a-hexahydro-1H-pyrido[4,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 178188651 |
| Molecular Formula | C8H12ClN3O3 |
| Molecular Weight | 233.66 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 7-chloro-8-methoxy-4a,5,6,7,8,8a-hexahydro-1H-pyrido[4,3-d]pyrimidine-2,4-dione |
| SMILES | COC1C(Cl)NCC2C(=O)NC(=O)NC21 |
| InChI | InChI=1S/C8H12ClN3O3/c1-15-5-4-3(2-10-6(5)9)7(13)12-8(14)11-4/h3-6,10H,2H2,1H3,(H2,11,12,13,14) |
| InChIKey | MCHDOXZPFXSQKU-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.66 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|