About 5-amino-1-methylpiperidin-2-one;methane
5-amino-1-methylpiperidin-2-one;methane (PubChem CID 178188727) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is 5-amino-1-methylpiperidin-2-one;methane.
Molecular Properties
| Compound Name | 5-amino-1-methylpiperidin-2-one;methane |
| PubChem CID | 178188727 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | 5-amino-1-methylpiperidin-2-one;methane |
| SMILES | C.CN1CC(N)CCC1=O |
| InChI | InChI=1S/C6H12N2O.CH4/c1-8-4-5(7)2-3-6(8)9;/h5H,2-4,7H2,1H3;1H4 |
| InChIKey | DESNOJPONROFBA-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-amino-1-methylpiperidin-2-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-methylpiperidin-2-one;methane?
The IUPAC name of 5-amino-1-methylpiperidin-2-one;methane (CID 178188727) is 5-amino-1-methylpiperidin-2-one;methane.
What is the SMILES notation for 5-amino-1-methylpiperidin-2-one;methane?
The canonical SMILES for 5-amino-1-methylpiperidin-2-one;methane is C.CN1CC(N)CCC1=O.
What is the InChIKey of 5-amino-1-methylpiperidin-2-one;methane?
The InChIKey is DESNOJPONROFBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.CH4/c1-8-4-5(7)2-3-6(8)9;/h5H,2-4,7H2,1H3;1H4.
What are the key properties of 5-amino-1-methylpiperidin-2-one;methane?
5-amino-1-methylpiperidin-2-one;methane has a molecular weight of 144.22 g/mol, XLogP of 0.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-methylpiperidin-2-one;methane is sourced from PubChem (CID 178188727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).