C10H6Br2O2 — CID 178188733
(1R,2S,6R,7R)-4,7-dibromotricyclo[5.2.1.02,6]deca-4,8-diene-3,10-dione (PubChem CID 178188733) has the molecular formula C10H6Br2O2 and a molecular weight of 317.96 g/mol. Its IUPAC name is (1R,2S,6R,7R)-4,7-dibromotricyclo[5.2.1.02,6]deca-4,8-diene-3,10-dione.
| Compound Name | (1R,2S,6R,7R)-4,7-dibromotricyclo[5.2.1.02,6]deca-4,8-diene-3,10-dione |
|---|---|
| PubChem CID | 178188733 |
| Molecular Formula | C10H6Br2O2 |
| Molecular Weight | 317.96 g/mol |
| Exact Mass | 315.87 |
| IUPAC Name | (1R,2S,6R,7R)-4,7-dibromotricyclo[5.2.1.02,6]deca-4,8-diene-3,10-dione |
| SMILES | O=C1C(Br)=C[C@H]2[C@@H]1[C@H]1C=C[C@]2(Br)C1=O |
| InChI | InChI=1S/C10H6Br2O2/c11-6-3-5-7(8(6)13)4-1-2-10(5,12)9(4)14/h1-5,7H/t4-,5+,7+,10-/m1/s1 |
| InChIKey | QPIIZGUQJCFMDJ-IBLRLFODSA-N |
| XLogP | 1.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.96 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|