C8H11N3O3 — CID 178188742
methyl 3-oxo-6,7,8,8a-tetrahydro-5H-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate (PubChem CID 178188742) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is methyl 3-oxo-6,7,8,8a-tetrahydro-5H-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate.
| Compound Name | methyl 3-oxo-6,7,8,8a-tetrahydro-5H-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 178188742 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | methyl 3-oxo-6,7,8,8a-tetrahydro-5H-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate |
| SMILES | COC(=O)C1CCCC2N=NC(=O)N21 |
| InChI | InChI=1S/C8H11N3O3/c1-14-7(12)5-3-2-4-6-9-10-8(13)11(5)6/h5-6H,2-4H2,1H3 |
| InChIKey | WUAZVPHOSGVLBU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |