About N-[(2-fluorophenyl)methyl]-5-methyl-1,2,4-triazolidin-3-imine
N-[(2-fluorophenyl)methyl]-5-methyl-1,2,4-triazolidin-3-imine (PubChem CID 178189314) has the molecular formula C10H13FN4
and a molecular weight of 208.24 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-5-methyl-1,2,4-triazolidin-3-imine.
Molecular Properties
| Compound Name | N-[(2-fluorophenyl)methyl]-5-methyl-1,2,4-triazolidin-3-imine |
| PubChem CID | 178189314 |
| Molecular Formula | C10H13FN4 |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-5-methyl-1,2,4-triazolidin-3-imine |
| SMILES | CC1NN/C(=N\Cc2ccccc2F)N1 |
| InChI | InChI=1S/C10H13FN4/c1-7-13-10(15-14-7)12-6-8-4-2-3-5-9(8)11/h2-5,7,14H,6H2,1H3,(H2,12,13,15) |
| InChIKey | VPFZFOFYOWFZDG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-fluorophenyl)methyl]-5-methyl-1,2,4-triazolidin-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-fluorophenyl)methyl]-5-methyl-1,2,4-triazolidin-3-imine?
The IUPAC name of N-[(2-fluorophenyl)methyl]-5-methyl-1,2,4-triazolidin-3-imine (CID 178189314) is N-[(2-fluorophenyl)methyl]-5-methyl-1,2,4-triazolidin-3-imine.
What is the SMILES notation for N-[(2-fluorophenyl)methyl]-5-methyl-1,2,4-triazolidin-3-imine?
The canonical SMILES for N-[(2-fluorophenyl)methyl]-5-methyl-1,2,4-triazolidin-3-imine is CC1NN/C(=N\Cc2ccccc2F)N1.
What is the InChIKey of N-[(2-fluorophenyl)methyl]-5-methyl-1,2,4-triazolidin-3-imine?
The InChIKey is VPFZFOFYOWFZDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FN4/c1-7-13-10(15-14-7)12-6-8-4-2-3-5-9(8)11/h2-5,7,14H,6H2,1H3,(H2,12,13,15).
What are the key properties of N-[(2-fluorophenyl)methyl]-5-methyl-1,2,4-triazolidin-3-imine?
N-[(2-fluorophenyl)methyl]-5-methyl-1,2,4-triazolidin-3-imine has a molecular weight of 208.24 g/mol, XLogP of 0.73, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-fluorophenyl)methyl]-5-methyl-1,2,4-triazolidin-3-imine is sourced from PubChem (CID 178189314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).