About 4-chloro-6-imino-5-nitro-1,3-diazinan-2-one
4-chloro-6-imino-5-nitro-1,3-diazinan-2-one (PubChem CID 178189645) has the molecular formula C4H5ClN4O3
and a molecular weight of 192.56 g/mol. Its IUPAC name is 4-chloro-6-imino-5-nitro-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 4-chloro-6-imino-5-nitro-1,3-diazinan-2-one |
| PubChem CID | 178189645 |
| Molecular Formula | C4H5ClN4O3 |
| Molecular Weight | 192.56 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | 4-chloro-6-imino-5-nitro-1,3-diazinan-2-one |
| SMILES | [H]/N=C1\NC(=O)NC(Cl)C1[N+](=O)[O-] |
| InChI | InChI=1S/C4H5ClN4O3/c5-2-1(9(11)12)3(6)8-4(10)7-2/h1-2H,(H3,6,7,8,10) |
| InChIKey | OSANZUKKNDTUIP-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.56 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-6-imino-5-nitro-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-imino-5-nitro-1,3-diazinan-2-one?
The IUPAC name of 4-chloro-6-imino-5-nitro-1,3-diazinan-2-one (CID 178189645) is 4-chloro-6-imino-5-nitro-1,3-diazinan-2-one.
What is the SMILES notation for 4-chloro-6-imino-5-nitro-1,3-diazinan-2-one?
The canonical SMILES for 4-chloro-6-imino-5-nitro-1,3-diazinan-2-one is [H]/N=C1\NC(=O)NC(Cl)C1[N+](=O)[O-].
What is the InChIKey of 4-chloro-6-imino-5-nitro-1,3-diazinan-2-one?
The InChIKey is OSANZUKKNDTUIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClN4O3/c5-2-1(9(11)12)3(6)8-4(10)7-2/h1-2H,(H3,6,7,8,10).
What are the key properties of 4-chloro-6-imino-5-nitro-1,3-diazinan-2-one?
4-chloro-6-imino-5-nitro-1,3-diazinan-2-one has a molecular weight of 192.56 g/mol, XLogP of -0.51, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-imino-5-nitro-1,3-diazinan-2-one is sourced from PubChem (CID 178189645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).