About 3-bromo-7-chloro-4aH-1,6-naphthyridin-2-one
3-bromo-7-chloro-4aH-1,6-naphthyridin-2-one (PubChem CID 178190260) has the molecular formula C8H4BrClN2O
and a molecular weight of 259.49 g/mol. Its IUPAC name is 3-bromo-7-chloro-4aH-1,6-naphthyridin-2-one.
Molecular Properties
| Compound Name | 3-bromo-7-chloro-4aH-1,6-naphthyridin-2-one |
| PubChem CID | 178190260 |
| Molecular Formula | C8H4BrClN2O |
| Molecular Weight | 259.49 g/mol |
| Exact Mass | 257.92 |
| IUPAC Name | 3-bromo-7-chloro-4aH-1,6-naphthyridin-2-one |
| SMILES | O=C1N=C2C=C(Cl)N=CC2C=C1Br |
| InChI | InChI=1S/C8H4BrClN2O/c9-5-1-4-3-11-7(10)2-6(4)12-8(5)13/h1-4H |
| InChIKey | JPKPNIWPAVNVNI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-7-chloro-4aH-1,6-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-7-chloro-4aH-1,6-naphthyridin-2-one?
The IUPAC name of 3-bromo-7-chloro-4aH-1,6-naphthyridin-2-one (CID 178190260) is 3-bromo-7-chloro-4aH-1,6-naphthyridin-2-one.
What is the SMILES notation for 3-bromo-7-chloro-4aH-1,6-naphthyridin-2-one?
The canonical SMILES for 3-bromo-7-chloro-4aH-1,6-naphthyridin-2-one is O=C1N=C2C=C(Cl)N=CC2C=C1Br.
What is the InChIKey of 3-bromo-7-chloro-4aH-1,6-naphthyridin-2-one?
The InChIKey is JPKPNIWPAVNVNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrClN2O/c9-5-1-4-3-11-7(10)2-6(4)12-8(5)13/h1-4H.
What are the key properties of 3-bromo-7-chloro-4aH-1,6-naphthyridin-2-one?
3-bromo-7-chloro-4aH-1,6-naphthyridin-2-one has a molecular weight of 259.49 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-7-chloro-4aH-1,6-naphthyridin-2-one is sourced from PubChem (CID 178190260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).