C8H14ClNO2 — CID 178190561
2-chloro-N-[(1R,3S)-3-(hydroxymethyl)cyclopentyl]acetamide (PubChem CID 178190561) has the molecular formula C8H14ClNO2 and a molecular weight of 191.66 g/mol. Its IUPAC name is 2-chloro-N-[(1R,3S)-3-(hydroxymethyl)cyclopentyl]acetamide.
| Compound Name | 2-chloro-N-[(1R,3S)-3-(hydroxymethyl)cyclopentyl]acetamide |
|---|---|
| PubChem CID | 178190561 |
| Molecular Formula | C8H14ClNO2 |
| Molecular Weight | 191.66 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 2-chloro-N-[(1R,3S)-3-(hydroxymethyl)cyclopentyl]acetamide |
| SMILES | O=C(CCl)N[C@@H]1CC[C@H](CO)C1 |
| InChI | InChI=1S/C8H14ClNO2/c9-4-8(12)10-7-2-1-6(3-7)5-11/h6-7,11H,1-5H2,(H,10,12)/t6-,7+/m0/s1 |
| InChIKey | PWTJBMDVWFCDDD-NKWVEPMBSA-N |
| XLogP | 0.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.66 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|