C12H21N — CID 178190786
(2R,3S,5S)-N-propyltricyclo[4.2.1.02,5]nonan-3-amine (PubChem CID 178190786) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (2R,3S,5S)-N-propyltricyclo[4.2.1.02,5]nonan-3-amine.
| Compound Name | (2R,3S,5S)-N-propyltricyclo[4.2.1.02,5]nonan-3-amine |
|---|---|
| PubChem CID | 178190786 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (2R,3S,5S)-N-propyltricyclo[4.2.1.02,5]nonan-3-amine |
| SMILES | CCCN[C@H]1C[C@H]2C3CCC(C3)[C@@H]12 |
| InChI | InChI=1S/C12H21N/c1-2-5-13-11-7-10-8-3-4-9(6-8)12(10)11/h8-13H,2-7H2,1H3/t8?,9?,10-,11-,12+/m0/s1 |
| InChIKey | GVLWFAHTHYVRAE-VJROTNAKSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |