About 3-[(1S,6S)-3-bicyclo[4.1.0]heptanyl]-1-methylpyrazol-5-amine
3-[(1S,6S)-3-bicyclo[4.1.0]heptanyl]-1-methylpyrazol-5-amine (PubChem CID 178191038) has the molecular formula C11H17N3
and a molecular weight of 191.28 g/mol. Its IUPAC name is 3-[(1S,6S)-3-bicyclo[4.1.0]heptanyl]-1-methylpyrazol-5-amine.
Molecular Properties
| Compound Name | 3-[(1S,6S)-3-bicyclo[4.1.0]heptanyl]-1-methylpyrazol-5-amine |
| PubChem CID | 178191038 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 3-[(1S,6S)-3-bicyclo[4.1.0]heptanyl]-1-methylpyrazol-5-amine |
| SMILES | Cn1nc(C2CC[C@H]3C[C@H]3C2)cc1N |
| InChI | InChI=1S/C11H17N3/c1-14-11(12)6-10(13-14)8-3-2-7-4-9(7)5-8/h6-9H,2-5,12H2,1H3/t7-,8?,9-/m0/s1 |
| InChIKey | HANXTSMCEGOTOM-SMOXQLQSSA-N |
| XLogP | 1.91 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(1S,6S)-3-bicyclo[4.1.0]heptanyl]-1-methylpyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S,6S)-3-bicyclo[4.1.0]heptanyl]-1-methylpyrazol-5-amine?
The IUPAC name of 3-[(1S,6S)-3-bicyclo[4.1.0]heptanyl]-1-methylpyrazol-5-amine (CID 178191038) is 3-[(1S,6S)-3-bicyclo[4.1.0]heptanyl]-1-methylpyrazol-5-amine.
What is the SMILES notation for 3-[(1S,6S)-3-bicyclo[4.1.0]heptanyl]-1-methylpyrazol-5-amine?
The canonical SMILES for 3-[(1S,6S)-3-bicyclo[4.1.0]heptanyl]-1-methylpyrazol-5-amine is Cn1nc(C2CC[C@H]3C[C@H]3C2)cc1N.
What is the InChIKey of 3-[(1S,6S)-3-bicyclo[4.1.0]heptanyl]-1-methylpyrazol-5-amine?
The InChIKey is HANXTSMCEGOTOM-SMOXQLQSSA-N. The full InChI is InChI=1S/C11H17N3/c1-14-11(12)6-10(13-14)8-3-2-7-4-9(7)5-8/h6-9H,2-5,12H2,1H3/t7-,8?,9-/m0/s1.
What are the key properties of 3-[(1S,6S)-3-bicyclo[4.1.0]heptanyl]-1-methylpyrazol-5-amine?
3-[(1S,6S)-3-bicyclo[4.1.0]heptanyl]-1-methylpyrazol-5-amine has a molecular weight of 191.28 g/mol, XLogP of 1.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S,6S)-3-bicyclo[4.1.0]heptanyl]-1-methylpyrazol-5-amine is sourced from PubChem (CID 178191038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).